About 2-[3-[[4-(4,5-difluoro-2-sulfanylphenyl)phenoxy]methyl]phenyl]-2-hydroxy-1-phenylethanone
2-[3-[[4-(4,5-difluoro-2-sulfanylphenyl)phenoxy]methyl]phenyl]-2-hydroxy-1-phenylethanone (PubChem CID 118913564) has the molecular formula C27H20F2O3S
and a molecular weight of 462.52 g/mol. Its IUPAC name is 2-[3-[[4-(4,5-difluoro-2-sulfanylphenyl)phenoxy]methyl]phenyl]-2-hydroxy-1-phenylethanone.
Molecular Properties
| Compound Name | 2-[3-[[4-(4,5-difluoro-2-sulfanylphenyl)phenoxy]methyl]phenyl]-2-hydroxy-1-phenylethanone |
| PubChem CID | 118913564 |
| Molecular Formula | C27H20F2O3S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 2-[3-[[4-(4,5-difluoro-2-sulfanylphenyl)phenoxy]methyl]phenyl]-2-hydroxy-1-phenylethanone |
| SMILES | O=C(c1ccccc1)C(O)c1cccc(COc2ccc(-c3cc(F)c(F)cc3S)cc2)c1 |
| InChI | InChI=1S/C27H20F2O3S/c28-23-14-22(25(33)15-24(23)29)18-9-11-21(12-10-18)32-16-17-5-4-8-20(13-17)27(31)26(30)19-6-2-1-3-7-19/h1-15,27,31,33H,16H2 |
| InChIKey | SWKNULJXYHUSNX-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[[4-(4,5-difluoro-2-sulfanylphenyl)phenoxy]methyl]phenyl]-2-hydroxy-1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[[4-(4,5-difluoro-2-sulfanylphenyl)phenoxy]methyl]phenyl]-2-hydroxy-1-phenylethanone?
The IUPAC name of 2-[3-[[4-(4,5-difluoro-2-sulfanylphenyl)phenoxy]methyl]phenyl]-2-hydroxy-1-phenylethanone (CID 118913564) is 2-[3-[[4-(4,5-difluoro-2-sulfanylphenyl)phenoxy]methyl]phenyl]-2-hydroxy-1-phenylethanone.
What is the SMILES notation for 2-[3-[[4-(4,5-difluoro-2-sulfanylphenyl)phenoxy]methyl]phenyl]-2-hydroxy-1-phenylethanone?
The canonical SMILES for 2-[3-[[4-(4,5-difluoro-2-sulfanylphenyl)phenoxy]methyl]phenyl]-2-hydroxy-1-phenylethanone is O=C(c1ccccc1)C(O)c1cccc(COc2ccc(-c3cc(F)c(F)cc3S)cc2)c1.
What is the InChIKey of 2-[3-[[4-(4,5-difluoro-2-sulfanylphenyl)phenoxy]methyl]phenyl]-2-hydroxy-1-phenylethanone?
The InChIKey is SWKNULJXYHUSNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H20F2O3S/c28-23-14-22(25(33)15-24(23)29)18-9-11-21(12-10-18)32-16-17-5-4-8-20(13-17)27(31)26(30)19-6-2-1-3-7-19/h1-15,27,31,33H,16H2.
What are the key properties of 2-[3-[[4-(4,5-difluoro-2-sulfanylphenyl)phenoxy]methyl]phenyl]-2-hydroxy-1-phenylethanone?
2-[3-[[4-(4,5-difluoro-2-sulfanylphenyl)phenoxy]methyl]phenyl]-2-hydroxy-1-phenylethanone has a molecular weight of 462.52 g/mol, XLogP of 6.42, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[[4-(4,5-difluoro-2-sulfanylphenyl)phenoxy]methyl]phenyl]-2-hydroxy-1-phenylethanone is sourced from PubChem (CID 118913564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).