C9H12O4 — CID 118913610
4-prop-2-enylcyclohexa-2,6-diene-1,2,4,5-tetrol (PubChem CID 118913610) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is 4-prop-2-enylcyclohexa-2,6-diene-1,2,4,5-tetrol.
| Compound Name | 4-prop-2-enylcyclohexa-2,6-diene-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 118913610 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 4-prop-2-enylcyclohexa-2,6-diene-1,2,4,5-tetrol |
| SMILES | C=CCC1(O)C=C(O)C(O)=CC1O |
| InChI | InChI=1S/C9H12O4/c1-2-3-9(13)5-7(11)6(10)4-8(9)12/h2,4-5,8,10-13H,1,3H2 |
| InChIKey | VKCQPILHGGZWOX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|