C24H30N2O2 — CID 11891365
[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] pentanoate (PubChem CID 11891365) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is [(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] pentanoate.
| Compound Name | [(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] pentanoate |
|---|---|
| PubChem CID | 11891365 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | [(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] pentanoate |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@H](OC(=O)CCCC)c1ccnc2ccccc12 |
| InChI | InChI=1S/C24H30N2O2/c1-3-5-10-23(27)28-24(20-11-13-25-21-9-7-6-8-19(20)21)22-15-18-12-14-26(22)16-17(18)4-2/h4,6-9,11,13,17-18,22,24H,2-3,5,10,12,14-16H2,1H3/t17-,18-,22-,24+/m0/s1 |
| InChIKey | LDLALKASHAUVJX-LOUMEOBWSA-N |
| XLogP | 4.91 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|