About 8-methyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione
8-methyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (PubChem CID 118913803) has the molecular formula C10H8O4
and a molecular weight of 192.17 g/mol. Its IUPAC name is 8-methyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
Molecular Properties
| Compound Name | 8-methyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| PubChem CID | 118913803 |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 8-methyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| SMILES | CC1=CC2C(=O)C1C1C(=O)OC(=O)C21 |
| InChI | InChI=1S/C10H8O4/c1-3-2-4-6-7(5(3)8(4)11)10(13)14-9(6)12/h2,4-7H,1H3 |
| InChIKey | LUPHGRUXRNMQJZ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione?
The IUPAC name of 8-methyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (CID 118913803) is 8-methyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
What is the SMILES notation for 8-methyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione?
The canonical SMILES for 8-methyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione is CC1=CC2C(=O)C1C1C(=O)OC(=O)C21.
What is the InChIKey of 8-methyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione?
The InChIKey is LUPHGRUXRNMQJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O4/c1-3-2-4-6-7(5(3)8(4)11)10(13)14-9(6)12/h2,4-7H,1H3.
What are the key properties of 8-methyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione?
8-methyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione has a molecular weight of 192.17 g/mol, XLogP of 0.08, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione is sourced from PubChem (CID 118913803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).