C35H25N4O4- — CID 118914362
(E)-3-[3-(2-methyl-4-pyridinyl)-6-nitro-1-tritylindazol-5-yl]prop-2-enoate (PubChem CID 118914362) has the molecular formula C35H25N4O4- and a molecular weight of 565.61 g/mol. Its IUPAC name is (E)-3-[3-(2-methyl-4-pyridinyl)-6-nitro-1-tritylindazol-5-yl]prop-2-enoate.
| Compound Name | (E)-3-[3-(2-methyl-4-pyridinyl)-6-nitro-1-tritylindazol-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 118914362 |
| Molecular Formula | C35H25N4O4- |
| Molecular Weight | 565.61 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | (E)-3-[3-(2-methyl-4-pyridinyl)-6-nitro-1-tritylindazol-5-yl]prop-2-enoate |
| SMILES | Cc1cc(-c2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3cc([N+](=O)[O-])c(/C=C/C(=O)[O-])cc23)ccn1 |
| InChI | InChI=1S/C35H26N4O4/c1-24-21-26(19-20-36-24)34-30-22-25(17-18-33(40)41)31(39(42)43)23-32(30)38(37-34)35(27-11-5-2-6-12-27,28-13-7-3-8-14-28)29-15-9-4-10-16-29/h2-23H,1H3,(H,40,41)/p-1/b18-17+ |
| InChIKey | DVXJBVNJPDXYNS-ISLYRVAYSA-M |
| XLogP | 5.92 |
| TPSA | 113.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.61 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|