C28H25Cl2F3N4 — CID 118916016
6-[bis(4-chlorophenyl)methyl]-N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]quinazolin-4-amine (PubChem CID 118916016) has the molecular formula C28H25Cl2F3N4 and a molecular weight of 545.44 g/mol. Its IUPAC name is 6-[bis(4-chlorophenyl)methyl]-N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]quinazolin-4-amine.
| Compound Name | 6-[bis(4-chlorophenyl)methyl]-N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 118916016 |
| Molecular Formula | C28H25Cl2F3N4 |
| Molecular Weight | 545.44 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 6-[bis(4-chlorophenyl)methyl]-N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]quinazolin-4-amine |
| SMILES | FC(F)(F)CN1CCC(Nc2ncnc3ccc(C(c4ccc(Cl)cc4)c4ccc(Cl)cc4)cc23)CC1 |
| InChI | InChI=1S/C28H25Cl2F3N4/c29-21-6-1-18(2-7-21)26(19-3-8-22(30)9-4-19)20-5-10-25-24(15-20)27(35-17-34-25)36-23-11-13-37(14-12-23)16-28(31,32)33/h1-10,15,17,23,26H,11-14,16H2,(H,34,35,36) |
| InChIKey | BZKRNMIFICHTGP-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.44 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|