C34H31Cl2N5O — CID 118916024
3-[[4-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]piperidin-1-yl]methyl]benzamide (PubChem CID 118916024) has the molecular formula C34H31Cl2N5O and a molecular weight of 596.56 g/mol. Its IUPAC name is 3-[[4-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]piperidin-1-yl]methyl]benzamide.
| Compound Name | 3-[[4-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]piperidin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 118916024 |
| Molecular Formula | C34H31Cl2N5O |
| Molecular Weight | 596.56 g/mol |
| Exact Mass | 595.19 |
| IUPAC Name | 3-[[4-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]piperidin-1-yl]methyl]benzamide |
| SMILES | NC(=O)c1cccc(CN2CCC(Nc3ncnc4ccc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)cc34)CC2)c1 |
| InChI | InChI=1S/C34H31Cl2N5O/c35-27-9-4-23(5-10-27)32(24-6-11-28(36)12-7-24)25-8-13-31-30(19-25)34(39-21-38-31)40-29-14-16-41(17-15-29)20-22-2-1-3-26(18-22)33(37)42/h1-13,18-19,21,29,32H,14-17,20H2,(H2,37,42)(H,38,39,40) |
| InChIKey | UFESXQXWDXVMDL-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.56 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|