C27H26Cl2N4O2S — CID 118916082
6-[bis(4-chlorophenyl)methyl]-N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]quinazolin-4-amine (PubChem CID 118916082) has the molecular formula C27H26Cl2N4O2S and a molecular weight of 541.50 g/mol. Its IUPAC name is 6-[bis(4-chlorophenyl)methyl]-N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]quinazolin-4-amine.
| Compound Name | 6-[bis(4-chlorophenyl)methyl]-N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 118916082 |
| Molecular Formula | C27H26Cl2N4O2S |
| Molecular Weight | 541.50 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | 6-[bis(4-chlorophenyl)methyl]-N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]quinazolin-4-amine |
| SMILES | O=S1(=O)CCN(CCNc2ncnc3ccc(C(c4ccc(Cl)cc4)c4ccc(Cl)cc4)cc23)CC1 |
| InChI | InChI=1S/C27H26Cl2N4O2S/c28-22-6-1-19(2-7-22)26(20-3-8-23(29)9-4-20)21-5-10-25-24(17-21)27(32-18-31-25)30-11-12-33-13-15-36(34,35)16-14-33/h1-10,17-18,26H,11-16H2,(H,30,31,32) |
| InChIKey | WFBGYXUFXBHCIC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|