C29H25Cl2F3N4O — CID 118916114
1-[4-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]piperidin-1-yl]-3,3,3-trifluoropropan-1-one (PubChem CID 118916114) has the molecular formula C29H25Cl2F3N4O and a molecular weight of 573.45 g/mol. Its IUPAC name is 1-[4-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]piperidin-1-yl]-3,3,3-trifluoropropan-1-one.
| Compound Name | 1-[4-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]piperidin-1-yl]-3,3,3-trifluoropropan-1-one |
|---|---|
| PubChem CID | 118916114 |
| Molecular Formula | C29H25Cl2F3N4O |
| Molecular Weight | 573.45 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | 1-[4-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]piperidin-1-yl]-3,3,3-trifluoropropan-1-one |
| SMILES | O=C(CC(F)(F)F)N1CCC(Nc2ncnc3ccc(C(c4ccc(Cl)cc4)c4ccc(Cl)cc4)cc23)CC1 |
| InChI | InChI=1S/C29H25Cl2F3N4O/c30-21-6-1-18(2-7-21)27(19-3-8-22(31)9-4-19)20-5-10-25-24(15-20)28(36-17-35-25)37-23-11-13-38(14-12-23)26(39)16-29(32,33)34/h1-10,15,17,23,27H,11-14,16H2,(H,35,36,37) |
| InChIKey | NNGOZJUFNOLNJZ-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.45 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|