C28H26Cl2F3N5O2S — CID 118916231
6-[bis(4-chlorophenyl)methyl]-2-N-methyl-4-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]quinazoline-2,4-diamine (PubChem CID 118916231) has the molecular formula C28H26Cl2F3N5O2S and a molecular weight of 624.52 g/mol. Its IUPAC name is 6-[bis(4-chlorophenyl)methyl]-2-N-methyl-4-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]quinazoline-2,4-diamine.
| Compound Name | 6-[bis(4-chlorophenyl)methyl]-2-N-methyl-4-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 118916231 |
| Molecular Formula | C28H26Cl2F3N5O2S |
| Molecular Weight | 624.52 g/mol |
| Exact Mass | 623.11 |
| IUPAC Name | 6-[bis(4-chlorophenyl)methyl]-2-N-methyl-4-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]quinazoline-2,4-diamine |
| SMILES | CNc1nc(NC2CCN(S(=O)(=O)C(F)(F)F)CC2)c2cc(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)ccc2n1 |
| InChI | InChI=1S/C28H26Cl2F3N5O2S/c1-34-27-36-24-11-6-19(25(17-2-7-20(29)8-3-17)18-4-9-21(30)10-5-18)16-23(24)26(37-27)35-22-12-14-38(15-13-22)41(39,40)28(31,32)33/h2-11,16,22,25H,12-15H2,1H3,(H2,34,35,36,37) |
| InChIKey | QHMLKVRBYNCRRP-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.52 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|