C9H16N+ — CID 118916334
1,4,5,6-tetramethyl-3,4-dihydropyridin-1-ium (PubChem CID 118916334) has the molecular formula C9H16N+ and a molecular weight of 138.23 g/mol. Its IUPAC name is 1,4,5,6-tetramethyl-3,4-dihydropyridin-1-ium.
| Compound Name | 1,4,5,6-tetramethyl-3,4-dihydropyridin-1-ium |
|---|---|
| PubChem CID | 118916334 |
| Molecular Formula | C9H16N+ |
| Molecular Weight | 138.23 g/mol |
| Exact Mass | 138.13 |
| IUPAC Name | 1,4,5,6-tetramethyl-3,4-dihydropyridin-1-ium |
| SMILES | CC1=C(C)[N+](C)=CCC1C |
| InChI | InChI=1S/C9H16N/c1-7-5-6-10(4)9(3)8(7)2/h6-7H,5H2,1-4H3/q+1 |
| InChIKey | AJCKWFZVTNBBDD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|