C16H17F3N4O5 — CID 118916339
[(2R,3S,4S,5S,6R)-5-azido-4-hydroxy-6-methyl-2-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate (PubChem CID 118916339) has the molecular formula C16H17F3N4O5 and a molecular weight of 402.33 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6R)-5-azido-4-hydroxy-6-methyl-2-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,5S,6R)-5-azido-4-hydroxy-6-methyl-2-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 118916339 |
| Molecular Formula | C16H17F3N4O5 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | [(2R,3S,4S,5S,6R)-5-azido-4-hydroxy-6-methyl-2-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](O/C(=N/c2ccccc2)C(F)(F)F)O[C@H](C)[C@@H](N=[N+]=[N-])[C@@H]1O |
| InChI | InChI=1S/C16H17F3N4O5/c1-8-11(22-23-20)12(25)13(27-9(2)24)14(26-8)28-15(16(17,18)19)21-10-6-4-3-5-7-10/h3-8,11-14,25H,1-2H3/b21-15+/t8-,11-,12+,13+,14-/m1/s1 |
| InChIKey | SCPHNJWVKSUKLZ-LNWSKDANSA-N |
| XLogP | 3.01 |
| TPSA | 126.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|