C15H17N3O4 — CID 118916511
(6E)-15-amino-3,11-dioxo-2,10-diazabicyclo[10.4.0]hexadeca-1(12),6,13,15-tetraene-9-carboxylic acid (PubChem CID 118916511) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is (6E)-15-amino-3,11-dioxo-2,10-diazabicyclo[10.4.0]hexadeca-1(12),6,13,15-tetraene-9-carboxylic acid.
| Compound Name | (6E)-15-amino-3,11-dioxo-2,10-diazabicyclo[10.4.0]hexadeca-1(12),6,13,15-tetraene-9-carboxylic acid |
|---|---|
| PubChem CID | 118916511 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | (6E)-15-amino-3,11-dioxo-2,10-diazabicyclo[10.4.0]hexadeca-1(12),6,13,15-tetraene-9-carboxylic acid |
| SMILES | Nc1ccc2c(c1)NC(=O)CC/C=C/CC(C(=O)O)NC2=O |
| InChI | InChI=1S/C15H17N3O4/c16-9-6-7-10-12(8-9)17-13(19)5-3-1-2-4-11(15(21)22)18-14(10)20/h1-2,6-8,11H,3-5,16H2,(H,17,19)(H,18,20)(H,21,22)/b2-1+ |
| InChIKey | PIQIQTWGRCPZRA-OWOJBTEDSA-N |
| XLogP | 1.13 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|