C25H21FN2O2 — CID 118916589
2-(2-fluorophenyl)-N-[[5-(3-methoxyphenyl)isoquinolin-8-yl]methyl]acetamide (PubChem CID 118916589) has the molecular formula C25H21FN2O2 and a molecular weight of 400.45 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-[[5-(3-methoxyphenyl)isoquinolin-8-yl]methyl]acetamide.
| Compound Name | 2-(2-fluorophenyl)-N-[[5-(3-methoxyphenyl)isoquinolin-8-yl]methyl]acetamide |
|---|---|
| PubChem CID | 118916589 |
| Molecular Formula | C25H21FN2O2 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-(2-fluorophenyl)-N-[[5-(3-methoxyphenyl)isoquinolin-8-yl]methyl]acetamide |
| SMILES | COc1cccc(-c2ccc(CNC(=O)Cc3ccccc3F)c3cnccc23)c1 |
| InChI | InChI=1S/C25H21FN2O2/c1-30-20-7-4-6-17(13-20)21-10-9-19(23-16-27-12-11-22(21)23)15-28-25(29)14-18-5-2-3-8-24(18)26/h2-13,16H,14-15H2,1H3,(H,28,29) |
| InChIKey | AHGWBITZFPWWCE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |