C23H16F6N3O6S+ — CID 118916665
[1-[(5-methylquinolin-4-yl)methyl]-2,4-dioxo-3-[4-(trifluoromethylsulfonyl)phenyl]imidazolidin-1-ium-1-yl] 2,2,2-trifluoroacetate (PubChem CID 118916665) has the molecular formula C23H16F6N3O6S+ and a molecular weight of 576.45 g/mol. Its IUPAC name is [1-[(5-methylquinolin-4-yl)methyl]-2,4-dioxo-3-[4-(trifluoromethylsulfonyl)phenyl]imidazolidin-1-ium-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [1-[(5-methylquinolin-4-yl)methyl]-2,4-dioxo-3-[4-(trifluoromethylsulfonyl)phenyl]imidazolidin-1-ium-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 118916665 |
| Molecular Formula | C23H16F6N3O6S+ |
| Molecular Weight | 576.45 g/mol |
| Exact Mass | 576.07 |
| IUPAC Name | [1-[(5-methylquinolin-4-yl)methyl]-2,4-dioxo-3-[4-(trifluoromethylsulfonyl)phenyl]imidazolidin-1-ium-1-yl] 2,2,2-trifluoroacetate |
| SMILES | Cc1cccc2nccc(C[N+]3(OC(=O)C(F)(F)F)CC(=O)N(c4ccc(S(=O)(=O)C(F)(F)F)cc4)C3=O)c12 |
| InChI | InChI=1S/C23H16F6N3O6S/c1-13-3-2-4-17-19(13)14(9-10-30-17)11-32(38-20(34)22(24,25)26)12-18(33)31(21(32)35)15-5-7-16(8-6-15)39(36,37)23(27,28)29/h2-10H,11-12H2,1H3/q+1 |
| InChIKey | QSPBTNWBGCMDHG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 110.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|