C19H24FN3O — CID 118916930
1-(4,4-dimethylcyclohexyl)-2-(10-fluoro-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl)ethanol (PubChem CID 118916930) has the molecular formula C19H24FN3O and a molecular weight of 329.42 g/mol. Its IUPAC name is 1-(4,4-dimethylcyclohexyl)-2-(10-fluoro-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl)ethanol.
| Compound Name | 1-(4,4-dimethylcyclohexyl)-2-(10-fluoro-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl)ethanol |
|---|---|
| PubChem CID | 118916930 |
| Molecular Formula | C19H24FN3O |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 1-(4,4-dimethylcyclohexyl)-2-(10-fluoro-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl)ethanol |
| SMILES | CC1(C)CCC(C(O)CC2c3nc(F)ccc3-c3cncn32)CC1 |
| InChI | InChI=1S/C19H24FN3O/c1-19(2)7-5-12(6-8-19)16(24)9-14-18-13(3-4-17(20)22-18)15-10-21-11-23(14)15/h3-4,10-12,14,16,24H,5-9H2,1-2H3 |
| InChIKey | HEYCBKURJHGQOB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|