C18H18F5N3O — CID 118916957
1-(4,4-difluorocyclohexyl)-2-[10-(trifluoromethyl)-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl]ethanol (PubChem CID 118916957) has the molecular formula C18H18F5N3O and a molecular weight of 387.35 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-2-[10-(trifluoromethyl)-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl]ethanol.
| Compound Name | 1-(4,4-difluorocyclohexyl)-2-[10-(trifluoromethyl)-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl]ethanol |
|---|---|
| PubChem CID | 118916957 |
| Molecular Formula | C18H18F5N3O |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-2-[10-(trifluoromethyl)-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl]ethanol |
| SMILES | OC(CC1c2nc(C(F)(F)F)ccc2-c2cncn21)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C18H18F5N3O/c19-17(20)5-3-10(4-6-17)14(27)7-12-16-11(13-8-24-9-26(12)13)1-2-15(25-16)18(21,22)23/h1-2,8-10,12,14,27H,3-7H2 |
| InChIKey | VBFFFDRNLWMSAL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |