About 2-(6-chloro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(1-fluorocyclohexyl)ethanol
2-(6-chloro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(1-fluorocyclohexyl)ethanol (PubChem CID 118916986) has the molecular formula C36H40Cl2F2N4O2
and a molecular weight of 669.64 g/mol. Its IUPAC name is 2-(6-chloro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(1-fluorocyclohexyl)ethanol.
Molecular Properties
| Compound Name | 2-(6-chloro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(1-fluorocyclohexyl)ethanol |
| PubChem CID | 118916986 |
| Molecular Formula | C36H40Cl2F2N4O2 |
| Molecular Weight | 669.64 g/mol |
| Exact Mass | 668.25 |
| IUPAC Name | 2-(6-chloro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(1-fluorocyclohexyl)ethanol |
| SMILES | OC(CC1c2c(Cl)cccc2-c2cncn21)C1(F)CCCCC1.OC(CC1c2c(Cl)cccc2-c2cncn21)C1(F)CCCCC1 |
| InChI | InChI=1S/2C18H20ClFN2O/c2*19-13-6-4-5-12-15-10-21-11-22(15)14(17(12)13)9-16(23)18(20)7-2-1-3-8-18/h2*4-6,10-11,14,16,23H,1-3,7-9H2 |
| InChIKey | WPUDHNUACTVNES-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 669.64 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(6-chloro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(1-fluorocyclohexyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chloro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(1-fluorocyclohexyl)ethanol?
The IUPAC name of 2-(6-chloro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(1-fluorocyclohexyl)ethanol (CID 118916986) is 2-(6-chloro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(1-fluorocyclohexyl)ethanol.
What is the SMILES notation for 2-(6-chloro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(1-fluorocyclohexyl)ethanol?
The canonical SMILES for 2-(6-chloro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(1-fluorocyclohexyl)ethanol is OC(CC1c2c(Cl)cccc2-c2cncn21)C1(F)CCCCC1.OC(CC1c2c(Cl)cccc2-c2cncn21)C1(F)CCCCC1.
What is the InChIKey of 2-(6-chloro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(1-fluorocyclohexyl)ethanol?
The InChIKey is WPUDHNUACTVNES-UHFFFAOYSA-N. The full InChI is InChI=1S/2C18H20ClFN2O/c2*19-13-6-4-5-12-15-10-21-11-22(15)14(17(12)13)9-16(23)18(20)7-2-1-3-8-18/h2*4-6,10-11,14,16,23H,1-3,7-9H2.
What are the key properties of 2-(6-chloro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(1-fluorocyclohexyl)ethanol?
2-(6-chloro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(1-fluorocyclohexyl)ethanol has a molecular weight of 669.64 g/mol, XLogP of 9.06, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-5H-imidazo[5,1-a]isoindol-5-yl)-1-(1-fluorocyclohexyl)ethanol is sourced from PubChem (CID 118916986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).