C19H17ClN4 — CID 118917201
4-[5-chloro-7-[[(3S)-pyrrolidin-3-yl]methyl]-1H-pyrrolo[3,2-b]pyridin-6-yl]benzonitrile (PubChem CID 118917201) has the molecular formula C19H17ClN4 and a molecular weight of 336.83 g/mol. Its IUPAC name is 4-[5-chloro-7-[[(3S)-pyrrolidin-3-yl]methyl]-1H-pyrrolo[3,2-b]pyridin-6-yl]benzonitrile.
| Compound Name | 4-[5-chloro-7-[[(3S)-pyrrolidin-3-yl]methyl]-1H-pyrrolo[3,2-b]pyridin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 118917201 |
| Molecular Formula | C19H17ClN4 |
| Molecular Weight | 336.83 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 4-[5-chloro-7-[[(3S)-pyrrolidin-3-yl]methyl]-1H-pyrrolo[3,2-b]pyridin-6-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2c(Cl)nc3cc[nH]c3c2C[C@H]2CCNC2)cc1 |
| InChI | InChI=1S/C19H17ClN4/c20-19-17(14-3-1-12(10-21)2-4-14)15(9-13-5-7-22-11-13)18-16(24-19)6-8-23-18/h1-4,6,8,13,22-23H,5,7,9,11H2/t13-/m1/s1 |
| InChIKey | YMRKLPAWVDVADW-CYBMUJFWSA-N |
| XLogP | 3.91 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.83 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|