About (E)-N-[(2S)-3-(3,5-difluorophenyl)-1-(methylamino)-1-oxopropan-2-yl]hept-2-enamide
(E)-N-[(2S)-3-(3,5-difluorophenyl)-1-(methylamino)-1-oxopropan-2-yl]hept-2-enamide (PubChem CID 118917416) has the molecular formula C17H22F2N2O2
and a molecular weight of 324.37 g/mol. Its IUPAC name is (E)-N-[(2S)-3-(3,5-difluorophenyl)-1-(methylamino)-1-oxopropan-2-yl]hept-2-enamide.
Molecular Properties
| Compound Name | (E)-N-[(2S)-3-(3,5-difluorophenyl)-1-(methylamino)-1-oxopropan-2-yl]hept-2-enamide |
| PubChem CID | 118917416 |
| Molecular Formula | C17H22F2N2O2 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (E)-N-[(2S)-3-(3,5-difluorophenyl)-1-(methylamino)-1-oxopropan-2-yl]hept-2-enamide |
| SMILES | CCCC/C=C/C(=O)N[C@@H](Cc1cc(F)cc(F)c1)C(=O)NC |
| InChI | InChI=1S/C17H22F2N2O2/c1-3-4-5-6-7-16(22)21-15(17(23)20-2)10-12-8-13(18)11-14(19)9-12/h6-9,11,15H,3-5,10H2,1-2H3,(H,20,23)(H,21,22)/b7-6+/t15-/m0/s1 |
| InChIKey | LNVXCLMBIWDXNK-LFAOLKIESA-N |
| XLogP | 2.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[(2S)-3-(3,5-difluorophenyl)-1-(methylamino)-1-oxopropan-2-yl]hept-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[(2S)-3-(3,5-difluorophenyl)-1-(methylamino)-1-oxopropan-2-yl]hept-2-enamide?
The IUPAC name of (E)-N-[(2S)-3-(3,5-difluorophenyl)-1-(methylamino)-1-oxopropan-2-yl]hept-2-enamide (CID 118917416) is (E)-N-[(2S)-3-(3,5-difluorophenyl)-1-(methylamino)-1-oxopropan-2-yl]hept-2-enamide.
What is the SMILES notation for (E)-N-[(2S)-3-(3,5-difluorophenyl)-1-(methylamino)-1-oxopropan-2-yl]hept-2-enamide?
The canonical SMILES for (E)-N-[(2S)-3-(3,5-difluorophenyl)-1-(methylamino)-1-oxopropan-2-yl]hept-2-enamide is CCCC/C=C/C(=O)N[C@@H](Cc1cc(F)cc(F)c1)C(=O)NC.
What is the InChIKey of (E)-N-[(2S)-3-(3,5-difluorophenyl)-1-(methylamino)-1-oxopropan-2-yl]hept-2-enamide?
The InChIKey is LNVXCLMBIWDXNK-LFAOLKIESA-N. The full InChI is InChI=1S/C17H22F2N2O2/c1-3-4-5-6-7-16(22)21-15(17(23)20-2)10-12-8-13(18)11-14(19)9-12/h6-9,11,15H,3-5,10H2,1-2H3,(H,20,23)(H,21,22)/b7-6+/t15-/m0/s1.
What are the key properties of (E)-N-[(2S)-3-(3,5-difluorophenyl)-1-(methylamino)-1-oxopropan-2-yl]hept-2-enamide?
(E)-N-[(2S)-3-(3,5-difluorophenyl)-1-(methylamino)-1-oxopropan-2-yl]hept-2-enamide has a molecular weight of 324.37 g/mol, XLogP of 2.48, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[(2S)-3-(3,5-difluorophenyl)-1-(methylamino)-1-oxopropan-2-yl]hept-2-enamide is sourced from PubChem (CID 118917416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).