C17H18ClN3O2 — CID 118917569
6-chloro-N-[(2R)-2-hydroxy-2-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]ethyl]pyridine-3-carboxamide (PubChem CID 118917569) has the molecular formula C17H18ClN3O2 and a molecular weight of 331.80 g/mol. Its IUPAC name is 6-chloro-N-[(2R)-2-hydroxy-2-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]ethyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[(2R)-2-hydroxy-2-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118917569 |
| Molecular Formula | C17H18ClN3O2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 6-chloro-N-[(2R)-2-hydroxy-2-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NC[C@@H](O)[C@@H]1Cc2ccccc2CN1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C17H18ClN3O2/c18-16-6-5-13(9-20-16)17(23)21-10-15(22)14-7-11-3-1-2-4-12(11)8-19-14/h1-6,9,14-15,19,22H,7-8,10H2,(H,21,23)/t14-,15+/m0/s1 |
| InChIKey | IEALJVUZMGFTNM-LSDHHAIUSA-N |
| XLogP | 1.54 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|