C11H13NO2S — CID 118918143
ethyl 6-ethylthieno[2,3-b]pyrrole-5-carboxylate (PubChem CID 118918143) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is ethyl 6-ethylthieno[2,3-b]pyrrole-5-carboxylate.
| Compound Name | ethyl 6-ethylthieno[2,3-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 118918143 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | ethyl 6-ethylthieno[2,3-b]pyrrole-5-carboxylate |
| SMILES | CCOC(=O)c1cc2ccsc2n1CC |
| InChI | InChI=1S/C11H13NO2S/c1-3-12-9(11(13)14-4-2)7-8-5-6-15-10(8)12/h5-7H,3-4H2,1-2H3 |
| InChIKey | MZISPIZLVVWUQT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |