C33H39N3O6 — CID 118918255
N-[3-[2,3-dihydro-1H-inden-2-yl-[dimethoxy(phenyl)methyl]amino]-2-hydroxypropyl]-4-(morpholine-4-carbonyl)benzamide (PubChem CID 118918255) has the molecular formula C33H39N3O6 and a molecular weight of 573.69 g/mol. Its IUPAC name is N-[3-[2,3-dihydro-1H-inden-2-yl-[dimethoxy(phenyl)methyl]amino]-2-hydroxypropyl]-4-(morpholine-4-carbonyl)benzamide.
| Compound Name | N-[3-[2,3-dihydro-1H-inden-2-yl-[dimethoxy(phenyl)methyl]amino]-2-hydroxypropyl]-4-(morpholine-4-carbonyl)benzamide |
|---|---|
| PubChem CID | 118918255 |
| Molecular Formula | C33H39N3O6 |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.28 |
| IUPAC Name | N-[3-[2,3-dihydro-1H-inden-2-yl-[dimethoxy(phenyl)methyl]amino]-2-hydroxypropyl]-4-(morpholine-4-carbonyl)benzamide |
| SMILES | COC(OC)(c1ccccc1)N(CC(O)CNC(=O)c1ccc(C(=O)N2CCOCC2)cc1)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C33H39N3O6/c1-40-33(41-2,28-10-4-3-5-11-28)36(29-20-26-8-6-7-9-27(26)21-29)23-30(37)22-34-31(38)24-12-14-25(15-13-24)32(39)35-16-18-42-19-17-35/h3-15,29-30,37H,16-23H2,1-2H3,(H,34,38) |
| InChIKey | IDXTXHGYIHBQBI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|