C24H23FIN5O5S — CID 118918637
1-[3-[5-(2-fluoro-4-iodoanilino)-6,8-dimethyl-2,4,7-trioxopyrido[4,3-d]pyrimidin-1-yl]phenyl]-N,N-dimethylmethanesulfonamide (PubChem CID 118918637) has the molecular formula C24H23FIN5O5S and a molecular weight of 639.45 g/mol. Its IUPAC name is 1-[3-[5-(2-fluoro-4-iodoanilino)-6,8-dimethyl-2,4,7-trioxopyrido[4,3-d]pyrimidin-1-yl]phenyl]-N,N-dimethylmethanesulfonamide.
| Compound Name | 1-[3-[5-(2-fluoro-4-iodoanilino)-6,8-dimethyl-2,4,7-trioxopyrido[4,3-d]pyrimidin-1-yl]phenyl]-N,N-dimethylmethanesulfonamide |
|---|---|
| PubChem CID | 118918637 |
| Molecular Formula | C24H23FIN5O5S |
| Molecular Weight | 639.45 g/mol |
| Exact Mass | 639.04 |
| IUPAC Name | 1-[3-[5-(2-fluoro-4-iodoanilino)-6,8-dimethyl-2,4,7-trioxopyrido[4,3-d]pyrimidin-1-yl]phenyl]-N,N-dimethylmethanesulfonamide |
| SMILES | Cc1c(=O)n(C)c(Nc2ccc(I)cc2F)c2c(=O)[nH]c(=O)n(-c3cccc(CS(=O)(=O)N(C)C)c3)c12 |
| InChI | InChI=1S/C24H23FIN5O5S/c1-13-20-19(21(30(4)23(13)33)27-18-9-8-15(26)11-17(18)25)22(32)28-24(34)31(20)16-7-5-6-14(10-16)12-37(35,36)29(2)3/h5-11,27H,12H2,1-4H3,(H,28,32,34) |
| InChIKey | LGHWNJRRTGQKHW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 126.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|