About CID 11891926
CID 11891926 (PubChem CID 11891926) has the molecular formula C12H16Br2O4
and a molecular weight of 384.06 g/mol.
Molecular Properties
| Compound Name | CID 11891926 |
| PubChem CID | 11891926 |
| Molecular Formula | C12H16Br2O4 |
| Molecular Weight | 384.06 g/mol |
| Exact Mass | 381.94 |
| IUPAC Name | — |
| SMILES | Br[C@H]1C[C@@H]2[C@@H](C[C@H](Br)C23OCCO3)C12OCCO2 |
| InChI | InChI=1S/C12H16Br2O4/c13-9-6-8-7(11(9)15-1-2-16-11)5-10(14)12(8)17-3-4-18-12/h7-10H,1-6H2/t7-,8-,9+,10+/m1/s1 |
| InChIKey | KTSSPGNMSGIYQK-IMSYWVGJSA-N |
| XLogP | 2.04 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.06 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze CID 11891926 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11891926?
The IUPAC name of CID 11891926 (CID 11891926) is not available.
What is the SMILES notation for CID 11891926?
The canonical SMILES for CID 11891926 is Br[C@H]1C[C@@H]2[C@@H](C[C@H](Br)C23OCCO3)C12OCCO2.
What is the InChIKey of CID 11891926?
The InChIKey is KTSSPGNMSGIYQK-IMSYWVGJSA-N. The full InChI is InChI=1S/C12H16Br2O4/c13-9-6-8-7(11(9)15-1-2-16-11)5-10(14)12(8)17-3-4-18-12/h7-10H,1-6H2/t7-,8-,9+,10+/m1/s1.
What are the key properties of CID 11891926?
CID 11891926 has a molecular weight of 384.06 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11891926 is sourced from PubChem (CID 11891926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).