C57H93N3O5 — CID 118919564
N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dioxopyrrolidin-3-yl]-N-hexylbenzamide (PubChem CID 118919564) has the molecular formula C57H93N3O5 and a molecular weight of 900.39 g/mol. Its IUPAC name is N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dioxopyrrolidin-3-yl]-N-hexylbenzamide.
| Compound Name | N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dioxopyrrolidin-3-yl]-N-hexylbenzamide |
|---|---|
| PubChem CID | 118919564 |
| Molecular Formula | C57H93N3O5 |
| Molecular Weight | 900.39 g/mol |
| Exact Mass | 899.71 |
| IUPAC Name | N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dioxopyrrolidin-3-yl]-N-hexylbenzamide |
| SMILES | CCCCCCCCC1C(CCCCCC)CCC(CCCCCCCCN2C(=O)C=CC2=O)C1CCCCCCCCN1C(=O)CC(N(CCCCCC)C(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C57H93N3O5/c1-4-7-10-13-19-28-37-50-47(33-24-11-8-5-2)39-40-48(34-25-18-14-16-21-31-44-59-53(61)41-42-54(59)62)51(50)38-29-20-15-17-22-32-45-60-55(63)46-52(57(60)65)58(43-30-12-9-6-3)56(64)49-35-26-23-27-36-49/h23,26-27,35-36,41-42,47-48,50-52H,4-22,24-25,28-34,37-40,43-46H2,1-3H3 |
| InChIKey | QYYVFHYEWRRLFO-UHFFFAOYSA-N |
| XLogP | 14.20 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.39 |
| LogP ≤ 5 | 14.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|