2,5-dimethylbenzoic acid

C9H10O2 — CID 11892

IUPAC2,5-dimethylbenzoic acid
SMILESCc1ccc(C)c(C(=O)O)c1
InChIInChI=1S/C9H10O2/c1-6-3-4-7(2)8(5-6)9(10)11/h3-5H,1-2H3,(H,10,11)
InChIKeyXZRHNAFEYMSXRG-UHFFFAOYSA-N
MW150.18 g/mol
LogP2.00
Rot. Bonds1

About 2,5-dimethylbenzoic acid

2,5-dimethylbenzoic acid (PubChem CID 11892) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is 2,5-dimethylbenzoic acid.

Molecular Properties

Compound Name2,5-dimethylbenzoic acid
PubChem CID11892
Molecular FormulaC9H10O2
Molecular Weight150.18 g/mol
Exact Mass150.07
IUPAC Name2,5-dimethylbenzoic acid
SMILESCc1ccc(C)c(C(=O)O)c1
InChIInChI=1S/C9H10O2/c1-6-3-4-7(2)8(5-6)9(10)11/h3-5H,1-2H3,(H,10,11)
InChIKeyXZRHNAFEYMSXRG-UHFFFAOYSA-N
XLogP2.00
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500150.18
LogP ≤ 52.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2,5-dimethylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-dimethylbenzoic acid?
The IUPAC name of 2,5-dimethylbenzoic acid (CID 11892) is 2,5-dimethylbenzoic acid.
What is the SMILES notation for 2,5-dimethylbenzoic acid?
The canonical SMILES for 2,5-dimethylbenzoic acid is Cc1ccc(C)c(C(=O)O)c1.
What is the InChIKey of 2,5-dimethylbenzoic acid?
The InChIKey is XZRHNAFEYMSXRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c1-6-3-4-7(2)8(5-6)9(10)11/h3-5H,1-2H3,(H,10,11).
What are the key properties of 2,5-dimethylbenzoic acid?
2,5-dimethylbenzoic acid has a molecular weight of 150.18 g/mol, XLogP of 2.00, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethylbenzoic acid is sourced from PubChem (CID 11892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).