C32H18F5NO — CID 118920522
7-[2,4-dimethyl-6-(2,3,4,5,6-pentafluorophenyl)phenyl]-[1]benzofuro[2,3-b]carbazole (PubChem CID 118920522) has the molecular formula C32H18F5NO and a molecular weight of 527.49 g/mol. Its IUPAC name is 7-[2,4-dimethyl-6-(2,3,4,5,6-pentafluorophenyl)phenyl]-[1]benzofuro[2,3-b]carbazole.
| Compound Name | 7-[2,4-dimethyl-6-(2,3,4,5,6-pentafluorophenyl)phenyl]-[1]benzofuro[2,3-b]carbazole |
|---|---|
| PubChem CID | 118920522 |
| Molecular Formula | C32H18F5NO |
| Molecular Weight | 527.49 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | 7-[2,4-dimethyl-6-(2,3,4,5,6-pentafluorophenyl)phenyl]-[1]benzofuro[2,3-b]carbazole |
| SMILES | Cc1cc(C)c(-n2c3ccccc3c3cc4c(cc32)oc2ccccc24)c(-c2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C32H18F5NO/c1-15-11-16(2)32(21(12-15)26-27(33)29(35)31(37)30(36)28(26)34)38-22-9-5-3-7-17(22)19-13-20-18-8-4-6-10-24(18)39-25(20)14-23(19)38/h3-14H,1-2H3 |
| InChIKey | RIFBPPJHVLPVLB-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.49 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|