C14H24BrNO6 — CID 118920759
2-bromo-4-(2-hydroxyethylcarbamoyl)-7-methoxy-2,6,6-trimethyl-7-oxoheptanoic acid (PubChem CID 118920759) has the molecular formula C14H24BrNO6 and a molecular weight of 382.25 g/mol. Its IUPAC name is 2-bromo-4-(2-hydroxyethylcarbamoyl)-7-methoxy-2,6,6-trimethyl-7-oxoheptanoic acid.
| Compound Name | 2-bromo-4-(2-hydroxyethylcarbamoyl)-7-methoxy-2,6,6-trimethyl-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 118920759 |
| Molecular Formula | C14H24BrNO6 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 2-bromo-4-(2-hydroxyethylcarbamoyl)-7-methoxy-2,6,6-trimethyl-7-oxoheptanoic acid |
| SMILES | COC(=O)C(C)(C)CC(CC(C)(Br)C(=O)O)C(=O)NCCO |
| InChI | InChI=1S/C14H24BrNO6/c1-13(2,12(21)22-4)7-9(10(18)16-5-6-17)8-14(3,15)11(19)20/h9,17H,5-8H2,1-4H3,(H,16,18)(H,19,20) |
| InChIKey | FEWVTKXOQISYQJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|