C18H28F2O7 — CID 118920793
ethyl 6-[(1R,2R)-1,2-diacetyloxybutyl]-2,3-difluoro-4,5-dimethyloxane-2-carboxylate (PubChem CID 118920793) has the molecular formula C18H28F2O7 and a molecular weight of 394.41 g/mol. Its IUPAC name is ethyl 6-[(1R,2R)-1,2-diacetyloxybutyl]-2,3-difluoro-4,5-dimethyloxane-2-carboxylate.
| Compound Name | ethyl 6-[(1R,2R)-1,2-diacetyloxybutyl]-2,3-difluoro-4,5-dimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 118920793 |
| Molecular Formula | C18H28F2O7 |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | ethyl 6-[(1R,2R)-1,2-diacetyloxybutyl]-2,3-difluoro-4,5-dimethyloxane-2-carboxylate |
| SMILES | CCOC(=O)C1(F)OC([C@H](OC(C)=O)[C@@H](CC)OC(C)=O)C(C)C(C)C1F |
| InChI | InChI=1S/C18H28F2O7/c1-7-13(25-11(5)21)15(26-12(6)22)14-9(3)10(4)16(19)18(20,27-14)17(23)24-8-2/h9-10,13-16H,7-8H2,1-6H3/t9?,10?,13-,14?,15-,16?,18?/m1/s1 |
| InChIKey | HVEKIGSKHRQLEZ-PKRWKIGHSA-N |
| XLogP | 2.50 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|