About 2-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]ethoxy]ethanol
2-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]ethoxy]ethanol (PubChem CID 118921875) has the molecular formula C7H9Cl2N3O3
and a molecular weight of 254.07 g/mol. Its IUPAC name is 2-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]ethoxy]ethanol.
Molecular Properties
| Compound Name | 2-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]ethoxy]ethanol |
| PubChem CID | 118921875 |
| Molecular Formula | C7H9Cl2N3O3 |
| Molecular Weight | 254.07 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | 2-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]ethoxy]ethanol |
| SMILES | OCCOCCOc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C7H9Cl2N3O3/c8-5-10-6(9)12-7(11-5)15-4-3-14-2-1-13/h13H,1-4H2 |
| InChIKey | NYIRMBPPWDRNGL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 77.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.07 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]ethoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]ethoxy]ethanol?
The IUPAC name of 2-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]ethoxy]ethanol (CID 118921875) is 2-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]ethoxy]ethanol.
What is the SMILES notation for 2-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]ethoxy]ethanol?
The canonical SMILES for 2-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]ethoxy]ethanol is OCCOCCOc1nc(Cl)nc(Cl)n1.
What is the InChIKey of 2-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]ethoxy]ethanol?
The InChIKey is NYIRMBPPWDRNGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9Cl2N3O3/c8-5-10-6(9)12-7(11-5)15-4-3-14-2-1-13/h13H,1-4H2.
What are the key properties of 2-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]ethoxy]ethanol?
2-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]ethoxy]ethanol has a molecular weight of 254.07 g/mol, XLogP of 0.57, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]ethoxy]ethanol is sourced from PubChem (CID 118921875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).