C29H40O10 — CID 118922973
[5,6,11-trihydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-13-(2-methylprop-2-enoyloxy)-7-oxo-3-oxapentacyclo[9.5.0.02,4.06,10.014,16]hexadec-8-en-14-yl] 2-methylbutanoate (PubChem CID 118922973) has the molecular formula C29H40O10 and a molecular weight of 548.63 g/mol. Its IUPAC name is [5,6,11-trihydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-13-(2-methylprop-2-enoyloxy)-7-oxo-3-oxapentacyclo[9.5.0.02,4.06,10.014,16]hexadec-8-en-14-yl] 2-methylbutanoate.
| Compound Name | [5,6,11-trihydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-13-(2-methylprop-2-enoyloxy)-7-oxo-3-oxapentacyclo[9.5.0.02,4.06,10.014,16]hexadec-8-en-14-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 118922973 |
| Molecular Formula | C29H40O10 |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | [5,6,11-trihydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-13-(2-methylprop-2-enoyloxy)-7-oxo-3-oxapentacyclo[9.5.0.02,4.06,10.014,16]hexadec-8-en-14-yl] 2-methylbutanoate |
| SMILES | C=C(C)C(=O)OC1C(C)C2(O)C(C3OC3(CO)C(O)C3(O)C(=O)C(C)=CC32)C2C(C)(C)C12OC(=O)C(C)CC |
| InChI | InChI=1S/C29H40O10/c1-9-13(4)23(33)39-29-18(25(29,7)8)17-21-26(11-30,38-21)24(34)28(36)16(10-14(5)19(28)31)27(17,35)15(6)20(29)37-22(32)12(2)3/h10,13,15-18,20-21,24,30,34-36H,2,9,11H2,1,3-8H3 |
| InChIKey | AUTHVHAYPXKATI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 163.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|