C16H21F4NO4 — CID 11892312
2,2,3,3-tetrafluoropropyl (1S,6R)-6-[[(2S)-oxolan-2-yl]methylcarbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 11892312) has the molecular formula C16H21F4NO4 and a molecular weight of 367.34 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl (1S,6R)-6-[[(2S)-oxolan-2-yl]methylcarbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | 2,2,3,3-tetrafluoropropyl (1S,6R)-6-[[(2S)-oxolan-2-yl]methylcarbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 11892312 |
| Molecular Formula | C16H21F4NO4 |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl (1S,6R)-6-[[(2S)-oxolan-2-yl]methylcarbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(OCC(F)(F)C(F)F)[C@H]1CC=CC[C@H]1C(=O)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C16H21F4NO4/c17-15(18)16(19,20)9-25-14(23)12-6-2-1-5-11(12)13(22)21-8-10-4-3-7-24-10/h1-2,10-12,15H,3-9H2,(H,21,22)/t10-,11+,12-/m0/s1 |
| InChIKey | RDXBMMHFPRBJRS-TUAOUCFPSA-N |
| XLogP | 2.31 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|