C19H18BrNO2 — CID 1189244
9-(4-bromophenyl)-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione (PubChem CID 1189244) has the molecular formula C19H18BrNO2 and a molecular weight of 372.26 g/mol. Its IUPAC name is 9-(4-bromophenyl)-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione.
| Compound Name | 9-(4-bromophenyl)-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 1189244 |
| Molecular Formula | C19H18BrNO2 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 9-(4-bromophenyl)-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione |
| SMILES | O=C1CCCC2=C1C(c1ccc(Br)cc1)C1=C(CCCC1=O)N2 |
| InChI | InChI=1S/C19H18BrNO2/c20-12-9-7-11(8-10-12)17-18-13(3-1-5-15(18)22)21-14-4-2-6-16(23)19(14)17/h7-10,17,21H,1-6H2 |
| InChIKey | UDVKUHQKCAZABX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |