About (2S)-3-ethenyl-4-[(Z)-3-methoxyprop-1-enyl]-1-methyl-2,5-dihydropyrrol-2-ol
(2S)-3-ethenyl-4-[(Z)-3-methoxyprop-1-enyl]-1-methyl-2,5-dihydropyrrol-2-ol (PubChem CID 118927885) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is (2S)-3-ethenyl-4-[(Z)-3-methoxyprop-1-enyl]-1-methyl-2,5-dihydropyrrol-2-ol.
Molecular Properties
| Compound Name | (2S)-3-ethenyl-4-[(Z)-3-methoxyprop-1-enyl]-1-methyl-2,5-dihydropyrrol-2-ol |
| PubChem CID | 118927885 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (2S)-3-ethenyl-4-[(Z)-3-methoxyprop-1-enyl]-1-methyl-2,5-dihydropyrrol-2-ol |
| SMILES | C=CC1=C(/C=C\COC)CN(C)[C@H]1O |
| InChI | InChI=1S/C11H17NO2/c1-4-10-9(6-5-7-14-3)8-12(2)11(10)13/h4-6,11,13H,1,7-8H2,2-3H3/b6-5-/t11-/m0/s1 |
| InChIKey | KJPZNBZKWFQVDT-GZTOBOFZSA-N |
| XLogP | 0.94 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-3-ethenyl-4-[(Z)-3-methoxyprop-1-enyl]-1-methyl-2,5-dihydropyrrol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-ethenyl-4-[(Z)-3-methoxyprop-1-enyl]-1-methyl-2,5-dihydropyrrol-2-ol?
The IUPAC name of (2S)-3-ethenyl-4-[(Z)-3-methoxyprop-1-enyl]-1-methyl-2,5-dihydropyrrol-2-ol (CID 118927885) is (2S)-3-ethenyl-4-[(Z)-3-methoxyprop-1-enyl]-1-methyl-2,5-dihydropyrrol-2-ol.
What is the SMILES notation for (2S)-3-ethenyl-4-[(Z)-3-methoxyprop-1-enyl]-1-methyl-2,5-dihydropyrrol-2-ol?
The canonical SMILES for (2S)-3-ethenyl-4-[(Z)-3-methoxyprop-1-enyl]-1-methyl-2,5-dihydropyrrol-2-ol is C=CC1=C(/C=C\COC)CN(C)[C@H]1O.
What is the InChIKey of (2S)-3-ethenyl-4-[(Z)-3-methoxyprop-1-enyl]-1-methyl-2,5-dihydropyrrol-2-ol?
The InChIKey is KJPZNBZKWFQVDT-GZTOBOFZSA-N. The full InChI is InChI=1S/C11H17NO2/c1-4-10-9(6-5-7-14-3)8-12(2)11(10)13/h4-6,11,13H,1,7-8H2,2-3H3/b6-5-/t11-/m0/s1.
What are the key properties of (2S)-3-ethenyl-4-[(Z)-3-methoxyprop-1-enyl]-1-methyl-2,5-dihydropyrrol-2-ol?
(2S)-3-ethenyl-4-[(Z)-3-methoxyprop-1-enyl]-1-methyl-2,5-dihydropyrrol-2-ol has a molecular weight of 195.26 g/mol, XLogP of 0.94, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-ethenyl-4-[(Z)-3-methoxyprop-1-enyl]-1-methyl-2,5-dihydropyrrol-2-ol is sourced from PubChem (CID 118927885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).