About (3Z)-5-hydroxy-2-methylidenehepta-3,5,6-trienenitrile
(3Z)-5-hydroxy-2-methylidenehepta-3,5,6-trienenitrile (PubChem CID 118928177) has the molecular formula C8H7NO
and a molecular weight of 133.15 g/mol. Its IUPAC name is (3Z)-5-hydroxy-2-methylidenehepta-3,5,6-trienenitrile.
Molecular Properties
| Compound Name | (3Z)-5-hydroxy-2-methylidenehepta-3,5,6-trienenitrile |
| PubChem CID | 118928177 |
| Molecular Formula | C8H7NO |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | (3Z)-5-hydroxy-2-methylidenehepta-3,5,6-trienenitrile |
| SMILES | C=C=C(O)/C=C\C(=C)C#N |
| InChI | InChI=1S/C8H7NO/c1-3-8(10)5-4-7(2)6-9/h4-5,10H,1-2H2/b5-4- |
| InChIKey | HWRJJUNFIOTZOC-PLNGDYQASA-N |
| XLogP | 1.85 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-5-hydroxy-2-methylidenehepta-3,5,6-trienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-5-hydroxy-2-methylidenehepta-3,5,6-trienenitrile?
The IUPAC name of (3Z)-5-hydroxy-2-methylidenehepta-3,5,6-trienenitrile (CID 118928177) is (3Z)-5-hydroxy-2-methylidenehepta-3,5,6-trienenitrile.
What is the SMILES notation for (3Z)-5-hydroxy-2-methylidenehepta-3,5,6-trienenitrile?
The canonical SMILES for (3Z)-5-hydroxy-2-methylidenehepta-3,5,6-trienenitrile is C=C=C(O)/C=C\C(=C)C#N.
What is the InChIKey of (3Z)-5-hydroxy-2-methylidenehepta-3,5,6-trienenitrile?
The InChIKey is HWRJJUNFIOTZOC-PLNGDYQASA-N. The full InChI is InChI=1S/C8H7NO/c1-3-8(10)5-4-7(2)6-9/h4-5,10H,1-2H2/b5-4-.
What are the key properties of (3Z)-5-hydroxy-2-methylidenehepta-3,5,6-trienenitrile?
(3Z)-5-hydroxy-2-methylidenehepta-3,5,6-trienenitrile has a molecular weight of 133.15 g/mol, XLogP of 1.85, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-5-hydroxy-2-methylidenehepta-3,5,6-trienenitrile is sourced from PubChem (CID 118928177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).