C16H24O6 — CID 118928204
ethyl (3E,5Z)-4-(methoxymethoxy)-3-(methoxymethoxymethyl)-2-methylideneocta-3,5,7-trienoate (PubChem CID 118928204) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is ethyl (3E,5Z)-4-(methoxymethoxy)-3-(methoxymethoxymethyl)-2-methylideneocta-3,5,7-trienoate.
| Compound Name | ethyl (3E,5Z)-4-(methoxymethoxy)-3-(methoxymethoxymethyl)-2-methylideneocta-3,5,7-trienoate |
|---|---|
| PubChem CID | 118928204 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | ethyl (3E,5Z)-4-(methoxymethoxy)-3-(methoxymethoxymethyl)-2-methylideneocta-3,5,7-trienoate |
| SMILES | C=C/C=C\C(OCOC)=C(/COCOC)C(=C)C(=O)OCC |
| InChI | InChI=1S/C16H24O6/c1-6-8-9-15(22-12-19-5)14(10-20-11-18-4)13(3)16(17)21-7-2/h6,8-9H,1,3,7,10-12H2,2,4-5H3/b9-8-,15-14- |
| InChIKey | QLRLWJRIEGURJK-FMUMETBJSA-N |
| XLogP | 2.34 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|