About (2Z,4E)-5-fluorohexa-2,4-diene-2-thiol
(2Z,4E)-5-fluorohexa-2,4-diene-2-thiol (PubChem CID 118928459) has the molecular formula C6H9FS
and a molecular weight of 132.20 g/mol. Its IUPAC name is (2Z,4E)-5-fluorohexa-2,4-diene-2-thiol.
Molecular Properties
| Compound Name | (2Z,4E)-5-fluorohexa-2,4-diene-2-thiol |
| PubChem CID | 118928459 |
| Molecular Formula | C6H9FS |
| Molecular Weight | 132.20 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | (2Z,4E)-5-fluorohexa-2,4-diene-2-thiol |
| SMILES | C/C(S)=C/C=C(\C)F |
| InChI | InChI=1S/C6H9FS/c1-5(7)3-4-6(2)8/h3-4,8H,1-2H3/b5-3+,6-4- |
| InChIKey | MDGBQAMWNVEPTL-UZNMPDEFSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.20 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-5-fluorohexa-2,4-diene-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-5-fluorohexa-2,4-diene-2-thiol?
The IUPAC name of (2Z,4E)-5-fluorohexa-2,4-diene-2-thiol (CID 118928459) is (2Z,4E)-5-fluorohexa-2,4-diene-2-thiol.
What is the SMILES notation for (2Z,4E)-5-fluorohexa-2,4-diene-2-thiol?
The canonical SMILES for (2Z,4E)-5-fluorohexa-2,4-diene-2-thiol is C/C(S)=C/C=C(\C)F.
What is the InChIKey of (2Z,4E)-5-fluorohexa-2,4-diene-2-thiol?
The InChIKey is MDGBQAMWNVEPTL-UZNMPDEFSA-N. The full InChI is InChI=1S/C6H9FS/c1-5(7)3-4-6(2)8/h3-4,8H,1-2H3/b5-3+,6-4-.
What are the key properties of (2Z,4E)-5-fluorohexa-2,4-diene-2-thiol?
(2Z,4E)-5-fluorohexa-2,4-diene-2-thiol has a molecular weight of 132.20 g/mol, XLogP of 2.69, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-5-fluorohexa-2,4-diene-2-thiol is sourced from PubChem (CID 118928459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).