About 2-[(5-methylcyclohexa-1,5-dien-1-yl)amino]acetamide
2-[(5-methylcyclohexa-1,5-dien-1-yl)amino]acetamide (PubChem CID 118928951) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-[(5-methylcyclohexa-1,5-dien-1-yl)amino]acetamide.
Molecular Properties
| Compound Name | 2-[(5-methylcyclohexa-1,5-dien-1-yl)amino]acetamide |
| PubChem CID | 118928951 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 2-[(5-methylcyclohexa-1,5-dien-1-yl)amino]acetamide |
| SMILES | CC1=CC(NCC(N)=O)=CCC1 |
| InChI | InChI=1S/C9H14N2O/c1-7-3-2-4-8(5-7)11-6-9(10)12/h4-5,11H,2-3,6H2,1H3,(H2,10,12) |
| InChIKey | ZNTDLGWOABSTFO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(5-methylcyclohexa-1,5-dien-1-yl)amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-methylcyclohexa-1,5-dien-1-yl)amino]acetamide?
The IUPAC name of 2-[(5-methylcyclohexa-1,5-dien-1-yl)amino]acetamide (CID 118928951) is 2-[(5-methylcyclohexa-1,5-dien-1-yl)amino]acetamide.
What is the SMILES notation for 2-[(5-methylcyclohexa-1,5-dien-1-yl)amino]acetamide?
The canonical SMILES for 2-[(5-methylcyclohexa-1,5-dien-1-yl)amino]acetamide is CC1=CC(NCC(N)=O)=CCC1.
What is the InChIKey of 2-[(5-methylcyclohexa-1,5-dien-1-yl)amino]acetamide?
The InChIKey is ZNTDLGWOABSTFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c1-7-3-2-4-8(5-7)11-6-9(10)12/h4-5,11H,2-3,6H2,1H3,(H2,10,12).
What are the key properties of 2-[(5-methylcyclohexa-1,5-dien-1-yl)amino]acetamide?
2-[(5-methylcyclohexa-1,5-dien-1-yl)amino]acetamide has a molecular weight of 166.22 g/mol, XLogP of 0.69, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-methylcyclohexa-1,5-dien-1-yl)amino]acetamide is sourced from PubChem (CID 118928951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).