C23H26N4O4 — CID 118929847
2-ethoxy-N-[(2R)-2-hydroxy-2-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]ethyl]-4-(5-methyl-1,3,4-oxadiazol-2-yl)benzamide (PubChem CID 118929847) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-ethoxy-N-[(2R)-2-hydroxy-2-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]ethyl]-4-(5-methyl-1,3,4-oxadiazol-2-yl)benzamide.
| Compound Name | 2-ethoxy-N-[(2R)-2-hydroxy-2-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]ethyl]-4-(5-methyl-1,3,4-oxadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 118929847 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-ethoxy-N-[(2R)-2-hydroxy-2-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]ethyl]-4-(5-methyl-1,3,4-oxadiazol-2-yl)benzamide |
| SMILES | CCOc1cc(-c2nnc(C)o2)ccc1C(=O)NC[C@@H](O)[C@@H]1Cc2ccccc2CN1 |
| InChI | InChI=1S/C23H26N4O4/c1-3-30-21-11-16(23-27-26-14(2)31-23)8-9-18(21)22(29)25-13-20(28)19-10-15-6-4-5-7-17(15)12-24-19/h4-9,11,19-20,24,28H,3,10,12-13H2,1-2H3,(H,25,29)/t19-,20+/m0/s1 |
| InChIKey | MQYQZQUWMJYNGF-VQTJNVASSA-N |
| XLogP | 2.25 |
| TPSA | 109.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |