C17H14FN5O — CID 118930200
3-fluoro-4-[[2-(1-methylpyrazol-4-yl)-1H-pyrrolo[3,2-c]pyridin-6-yl]amino]phenol (PubChem CID 118930200) has the molecular formula C17H14FN5O and a molecular weight of 323.33 g/mol. Its IUPAC name is 3-fluoro-4-[[2-(1-methylpyrazol-4-yl)-1H-pyrrolo[3,2-c]pyridin-6-yl]amino]phenol.
| Compound Name | 3-fluoro-4-[[2-(1-methylpyrazol-4-yl)-1H-pyrrolo[3,2-c]pyridin-6-yl]amino]phenol |
|---|---|
| PubChem CID | 118930200 |
| Molecular Formula | C17H14FN5O |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 3-fluoro-4-[[2-(1-methylpyrazol-4-yl)-1H-pyrrolo[3,2-c]pyridin-6-yl]amino]phenol |
| SMILES | Cn1cc(-c2cc3cnc(Nc4ccc(O)cc4F)cc3[nH]2)cn1 |
| InChI | InChI=1S/C17H14FN5O/c1-23-9-11(8-20-23)15-4-10-7-19-17(6-16(10)21-15)22-14-3-2-12(24)5-13(14)18/h2-9,21,24H,1H3,(H,19,22) |
| InChIKey | ZCPBAKDVPPSFLI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|