C25H21NO3S — CID 11893036
(4aS,8aS)-3-[(2R)-2-(1,2-dihydroacenaphthylen-5-yl)-1,3-thiazolidine-3-carbonyl]-4a,8a-dihydrochromen-2-one (PubChem CID 11893036) has the molecular formula C25H21NO3S and a molecular weight of 415.51 g/mol. Its IUPAC name is (4aS,8aS)-3-[(2R)-2-(1,2-dihydroacenaphthylen-5-yl)-1,3-thiazolidine-3-carbonyl]-4a,8a-dihydrochromen-2-one.
| Compound Name | (4aS,8aS)-3-[(2R)-2-(1,2-dihydroacenaphthylen-5-yl)-1,3-thiazolidine-3-carbonyl]-4a,8a-dihydrochromen-2-one |
|---|---|
| PubChem CID | 11893036 |
| Molecular Formula | C25H21NO3S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | (4aS,8aS)-3-[(2R)-2-(1,2-dihydroacenaphthylen-5-yl)-1,3-thiazolidine-3-carbonyl]-4a,8a-dihydrochromen-2-one |
| SMILES | O=C1O[C@H]2C=CC=C[C@H]2C=C1C(=O)N1CCS[C@@H]1c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C25H21NO3S/c27-23(20-14-17-4-1-2-7-21(17)29-25(20)28)26-12-13-30-24(26)19-11-10-16-9-8-15-5-3-6-18(19)22(15)16/h1-7,10-11,14,17,21,24H,8-9,12-13H2/t17-,21-,24+/m0/s1 |
| InChIKey | HEPBFKUCIJPUDJ-CODAWKSHSA-N |
| XLogP | 4.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|