C29H31F3N6O2S — CID 118930590
2-N-tert-butyl-8-N-[2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)ethyl]-5-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinoline-2,8-dicarboxamide (PubChem CID 118930590) has the molecular formula C29H31F3N6O2S and a molecular weight of 584.67 g/mol. Its IUPAC name is 2-N-tert-butyl-8-N-[2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)ethyl]-5-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinoline-2,8-dicarboxamide.
| Compound Name | 2-N-tert-butyl-8-N-[2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)ethyl]-5-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinoline-2,8-dicarboxamide |
|---|---|
| PubChem CID | 118930590 |
| Molecular Formula | C29H31F3N6O2S |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | 2-N-tert-butyl-8-N-[2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)ethyl]-5-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinoline-2,8-dicarboxamide |
| SMILES | Cc1nn2cc(CCNC(=O)c3ccc(-c4cccc(C(F)(F)F)c4)c4c3CN(C(=O)NC(C)(C)C)CC4)nc2s1 |
| InChI | InChI=1S/C29H31F3N6O2S/c1-17-36-38-15-20(34-27(38)41-17)10-12-33-25(39)23-9-8-21(18-6-5-7-19(14-18)29(30,31)32)22-11-13-37(16-24(22)23)26(40)35-28(2,3)4/h5-9,14-15H,10-13,16H2,1-4H3,(H,33,39)(H,35,40) |
| InChIKey | HCBRMZOYIAUILB-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 91.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |