C36H30ClF2N3O — CID 118931048
(E)-3-[6-chloro-3-(1-tritylimidazol-4-yl)-2-pyridinyl]-1-(4,4-difluorocyclohexyl)prop-2-en-1-one (PubChem CID 118931048) has the molecular formula C36H30ClF2N3O and a molecular weight of 594.11 g/mol. Its IUPAC name is (E)-3-[6-chloro-3-(1-tritylimidazol-4-yl)-2-pyridinyl]-1-(4,4-difluorocyclohexyl)prop-2-en-1-one.
| Compound Name | (E)-3-[6-chloro-3-(1-tritylimidazol-4-yl)-2-pyridinyl]-1-(4,4-difluorocyclohexyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 118931048 |
| Molecular Formula | C36H30ClF2N3O |
| Molecular Weight | 594.11 g/mol |
| Exact Mass | 593.20 |
| IUPAC Name | (E)-3-[6-chloro-3-(1-tritylimidazol-4-yl)-2-pyridinyl]-1-(4,4-difluorocyclohexyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1nc(Cl)ccc1-c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C36H30ClF2N3O/c37-34-19-16-30(31(41-34)17-18-33(43)26-20-22-35(38,39)23-21-26)32-24-42(25-40-32)36(27-10-4-1-5-11-27,28-12-6-2-7-13-28)29-14-8-3-9-15-29/h1-19,24-26H,20-23H2/b18-17+ |
| InChIKey | LJOJOXMZFXRINV-ISLYRVAYSA-N |
| XLogP | 8.85 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.11 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|