C37H32ClFN2O — CID 118931091
(E)-3-[2-chloro-6-(1-tritylimidazol-4-yl)phenyl]-1-(1-fluorocyclohexyl)prop-2-en-1-one (PubChem CID 118931091) has the molecular formula C37H32ClFN2O and a molecular weight of 575.13 g/mol. Its IUPAC name is (E)-3-[2-chloro-6-(1-tritylimidazol-4-yl)phenyl]-1-(1-fluorocyclohexyl)prop-2-en-1-one.
| Compound Name | (E)-3-[2-chloro-6-(1-tritylimidazol-4-yl)phenyl]-1-(1-fluorocyclohexyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 118931091 |
| Molecular Formula | C37H32ClFN2O |
| Molecular Weight | 575.13 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | (E)-3-[2-chloro-6-(1-tritylimidazol-4-yl)phenyl]-1-(1-fluorocyclohexyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1c(Cl)cccc1-c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)C1(F)CCCCC1 |
| InChI | InChI=1S/C37H32ClFN2O/c38-33-21-13-20-32(31(33)22-23-35(42)36(39)24-11-4-12-25-36)34-26-41(27-40-34)37(28-14-5-1-6-15-28,29-16-7-2-8-17-29)30-18-9-3-10-19-30/h1-3,5-10,13-23,26-27H,4,11-12,24-25H2/b23-22+ |
| InChIKey | SVPJBEPWOOIXHI-GHVJWSGMSA-N |
| XLogP | 9.30 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.13 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|