C31H37N5O4S — CID 118931274
4-methyl-N-[3-(morpholin-4-ylmethyl)-2-[(4-piperidin-4-yloxyphenoxy)methyl]phenyl]thieno[3,2-b]pyrrole-5-carbohydrazide (PubChem CID 118931274) has the molecular formula C31H37N5O4S and a molecular weight of 575.74 g/mol. Its IUPAC name is 4-methyl-N-[3-(morpholin-4-ylmethyl)-2-[(4-piperidin-4-yloxyphenoxy)methyl]phenyl]thieno[3,2-b]pyrrole-5-carbohydrazide.
| Compound Name | 4-methyl-N-[3-(morpholin-4-ylmethyl)-2-[(4-piperidin-4-yloxyphenoxy)methyl]phenyl]thieno[3,2-b]pyrrole-5-carbohydrazide |
|---|---|
| PubChem CID | 118931274 |
| Molecular Formula | C31H37N5O4S |
| Molecular Weight | 575.74 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | 4-methyl-N-[3-(morpholin-4-ylmethyl)-2-[(4-piperidin-4-yloxyphenoxy)methyl]phenyl]thieno[3,2-b]pyrrole-5-carbohydrazide |
| SMILES | Cn1c(C(=O)N(N)c2cccc(CN3CCOCC3)c2COc2ccc(OC3CCNCC3)cc2)cc2sccc21 |
| InChI | InChI=1S/C31H37N5O4S/c1-34-28-11-18-41-30(28)19-29(34)31(37)36(32)27-4-2-3-22(20-35-14-16-38-17-15-35)26(27)21-39-23-5-7-24(8-6-23)40-25-9-12-33-13-10-25/h2-8,11,18-19,25,33H,9-10,12-17,20-21,32H2,1H3 |
| InChIKey | POGLBFWMCSRTSV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.74 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|