C27H31ClN4O5 — CID 118931283
methyl N-[9-[3-(3-chlorophenyl)pyrrolidine-1-carbonyl]-3,11-dioxo-2,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]carbamate (PubChem CID 118931283) has the molecular formula C27H31ClN4O5 and a molecular weight of 527.02 g/mol. Its IUPAC name is methyl N-[9-[3-(3-chlorophenyl)pyrrolidine-1-carbonyl]-3,11-dioxo-2,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]carbamate.
| Compound Name | methyl N-[9-[3-(3-chlorophenyl)pyrrolidine-1-carbonyl]-3,11-dioxo-2,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]carbamate |
|---|---|
| PubChem CID | 118931283 |
| Molecular Formula | C27H31ClN4O5 |
| Molecular Weight | 527.02 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | methyl N-[9-[3-(3-chlorophenyl)pyrrolidine-1-carbonyl]-3,11-dioxo-2,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)NC(=O)CCCCCC(C(=O)N1CCC(c3cccc(Cl)c3)C1)NC2=O |
| InChI | InChI=1S/C27H31ClN4O5/c1-37-27(36)29-20-10-11-21-23(15-20)30-24(33)9-4-2-3-8-22(31-25(21)34)26(35)32-13-12-18(16-32)17-6-5-7-19(28)14-17/h5-7,10-11,14-15,18,22H,2-4,8-9,12-13,16H2,1H3,(H,29,36)(H,30,33)(H,31,34) |
| InChIKey | IMVKYBVDJWTGHH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.02 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |