About N-methyl-N-(3-methylpentan-3-yl)-2,6-di(propan-2-yl)aniline
N-methyl-N-(3-methylpentan-3-yl)-2,6-di(propan-2-yl)aniline (PubChem CID 118933000) has the molecular formula C19H33N
and a molecular weight of 275.48 g/mol. Its IUPAC name is N-methyl-N-(3-methylpentan-3-yl)-2,6-di(propan-2-yl)aniline.
Molecular Properties
| Compound Name | N-methyl-N-(3-methylpentan-3-yl)-2,6-di(propan-2-yl)aniline |
| PubChem CID | 118933000 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | N-methyl-N-(3-methylpentan-3-yl)-2,6-di(propan-2-yl)aniline |
| SMILES | CCC(C)(CC)N(C)c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C19H33N/c1-9-19(7,10-2)20(8)18-16(14(3)4)12-11-13-17(18)15(5)6/h11-15H,9-10H2,1-8H3 |
| InChIKey | LUFZOPKZJAHRMG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methyl-N-(3-methylpentan-3-yl)-2,6-di(propan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-(3-methylpentan-3-yl)-2,6-di(propan-2-yl)aniline?
The IUPAC name of N-methyl-N-(3-methylpentan-3-yl)-2,6-di(propan-2-yl)aniline (CID 118933000) is N-methyl-N-(3-methylpentan-3-yl)-2,6-di(propan-2-yl)aniline.
What is the SMILES notation for N-methyl-N-(3-methylpentan-3-yl)-2,6-di(propan-2-yl)aniline?
The canonical SMILES for N-methyl-N-(3-methylpentan-3-yl)-2,6-di(propan-2-yl)aniline is CCC(C)(CC)N(C)c1c(C(C)C)cccc1C(C)C.
What is the InChIKey of N-methyl-N-(3-methylpentan-3-yl)-2,6-di(propan-2-yl)aniline?
The InChIKey is LUFZOPKZJAHRMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33N/c1-9-19(7,10-2)20(8)18-16(14(3)4)12-11-13-17(18)15(5)6/h11-15H,9-10H2,1-8H3.
What are the key properties of N-methyl-N-(3-methylpentan-3-yl)-2,6-di(propan-2-yl)aniline?
N-methyl-N-(3-methylpentan-3-yl)-2,6-di(propan-2-yl)aniline has a molecular weight of 275.48 g/mol, XLogP of 5.95, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-(3-methylpentan-3-yl)-2,6-di(propan-2-yl)aniline is sourced from PubChem (CID 118933000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).