C17H12N2S — CID 118933081
17-methyl-13-thia-9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2,4,6,8,10,14(18),15-octaene (PubChem CID 118933081) has the molecular formula C17H12N2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 17-methyl-13-thia-9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2,4,6,8,10,14(18),15-octaene.
| Compound Name | 17-methyl-13-thia-9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2,4,6,8,10,14(18),15-octaene |
|---|---|
| PubChem CID | 118933081 |
| Molecular Formula | C17H12N2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 17-methyl-13-thia-9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2,4,6,8,10,14(18),15-octaene |
| SMILES | Cc1ccc2c3c1c1ccccc1c1ncc(n13)CS2 |
| InChI | InChI=1S/C17H12N2S/c1-10-6-7-14-16-15(10)12-4-2-3-5-13(12)17-18-8-11(9-20-14)19(16)17/h2-8H,9H2,1H3 |
| InChIKey | QKHPDICUDPZNPL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|