About 2-ethylsulfanyl-N-methyl-1,2-dihydropyridin-3-amine
2-ethylsulfanyl-N-methyl-1,2-dihydropyridin-3-amine (PubChem CID 118933271) has the molecular formula C8H14N2S
and a molecular weight of 170.28 g/mol. Its IUPAC name is 2-ethylsulfanyl-N-methyl-1,2-dihydropyridin-3-amine.
Molecular Properties
| Compound Name | 2-ethylsulfanyl-N-methyl-1,2-dihydropyridin-3-amine |
| PubChem CID | 118933271 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 2-ethylsulfanyl-N-methyl-1,2-dihydropyridin-3-amine |
| SMILES | CCSC1NC=CC=C1NC |
| InChI | InChI=1S/C8H14N2S/c1-3-11-8-7(9-2)5-4-6-10-8/h4-6,8-10H,3H2,1-2H3 |
| InChIKey | INXXCBPMLHTIKW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethylsulfanyl-N-methyl-1,2-dihydropyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfanyl-N-methyl-1,2-dihydropyridin-3-amine?
The IUPAC name of 2-ethylsulfanyl-N-methyl-1,2-dihydropyridin-3-amine (CID 118933271) is 2-ethylsulfanyl-N-methyl-1,2-dihydropyridin-3-amine.
What is the SMILES notation for 2-ethylsulfanyl-N-methyl-1,2-dihydropyridin-3-amine?
The canonical SMILES for 2-ethylsulfanyl-N-methyl-1,2-dihydropyridin-3-amine is CCSC1NC=CC=C1NC.
What is the InChIKey of 2-ethylsulfanyl-N-methyl-1,2-dihydropyridin-3-amine?
The InChIKey is INXXCBPMLHTIKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2S/c1-3-11-8-7(9-2)5-4-6-10-8/h4-6,8-10H,3H2,1-2H3.
What are the key properties of 2-ethylsulfanyl-N-methyl-1,2-dihydropyridin-3-amine?
2-ethylsulfanyl-N-methyl-1,2-dihydropyridin-3-amine has a molecular weight of 170.28 g/mol, XLogP of 1.29, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfanyl-N-methyl-1,2-dihydropyridin-3-amine is sourced from PubChem (CID 118933271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).